C6H13NO — CID 124578103
[(2R,4S)-4-methyloxolan-2-yl]methanamine (PubChem CID 124578103) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is [(2R,4S)-4-methyloxolan-2-yl]methanamine.
| Compound Name | [(2R,4S)-4-methyloxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 124578103 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | [(2R,4S)-4-methyloxolan-2-yl]methanamine |
| SMILES | C[C@@H]1CO[C@@H](CN)C1 |
| InChI | InChI=1S/C6H13NO/c1-5-2-6(3-7)8-4-5/h5-6H,2-4,7H2,1H3/t5-,6+/m0/s1 |
| InChIKey | UEKXFVCDYQNMAC-NTSWFWBYSA-N |
| XLogP | 0.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |