C6H13AlFNO — CID 163524804
(2R,3S,5S)-2-alumanyl-4-fluoro-5-methyloxan-3-amine (PubChem CID 163524804) has the molecular formula C6H13AlFNO and a molecular weight of 161.16 g/mol. Its IUPAC name is (2R,3S,5S)-2-alumanyl-4-fluoro-5-methyloxan-3-amine.
| Compound Name | (2R,3S,5S)-2-alumanyl-4-fluoro-5-methyloxan-3-amine |
|---|---|
| PubChem CID | 163524804 |
| Molecular Formula | C6H13AlFNO |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (2R,3S,5S)-2-alumanyl-4-fluoro-5-methyloxan-3-amine |
| SMILES | C[C@H]1CO[C@H]([AlH2])[C@@H](N)C1F |
| InChI | InChI=1S/C6H11FNO.Al.2H/c1-4-2-9-3-5(8)6(4)7;;;/h3-6H,2,8H2,1H3;;;/t4-,5+,6?;;;/m0.../s1 |
| InChIKey | DNVNOTIORADJJU-OKGDMBFWSA-N |
| XLogP | -0.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |