C16H34O2 — CID 144529308
1,4-dimethylcyclohexane;2,5-dimethyl-1,3-dioxane;ethane (PubChem CID 144529308) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;2,5-dimethyl-1,3-dioxane;ethane.
| Compound Name | 1,4-dimethylcyclohexane;2,5-dimethyl-1,3-dioxane;ethane |
|---|---|
| PubChem CID | 144529308 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 1,4-dimethylcyclohexane;2,5-dimethyl-1,3-dioxane;ethane |
| SMILES | CC.CC1CCC(C)CC1.CC1COC(C)OC1 |
| InChI | InChI=1S/C8H16.C6H12O2.C2H6/c1-7-3-5-8(2)6-4-7;1-5-3-7-6(2)8-4-5;1-2/h7-8H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | ZQSCPJCTCVRWFM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |