C15H34O3 — CID 158485618
2,5-dimethyl-1,3-dioxane;2,5-dimethyloxane;methane (PubChem CID 158485618) has the molecular formula C15H34O3 and a molecular weight of 262.43 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-dioxane;2,5-dimethyloxane;methane.
| Compound Name | 2,5-dimethyl-1,3-dioxane;2,5-dimethyloxane;methane |
|---|---|
| PubChem CID | 158485618 |
| Molecular Formula | C15H34O3 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 2,5-dimethyl-1,3-dioxane;2,5-dimethyloxane;methane |
| SMILES | C.C.CC1CCC(C)OC1.CC1COC(C)OC1 |
| InChI | InChI=1S/C7H14O.C6H12O2.2CH4/c1-6-3-4-7(2)8-5-6;1-5-3-7-6(2)8-4-5;;/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3;2*1H4 |
| InChIKey | HIBGQMSLQNOXNH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |