C15H30O2 — CID 144941728
2,5-dimethyl-1,3-dioxane;1,2,4-trimethylcyclohexane (PubChem CID 144941728) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-dioxane;1,2,4-trimethylcyclohexane.
| Compound Name | 2,5-dimethyl-1,3-dioxane;1,2,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 144941728 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2,5-dimethyl-1,3-dioxane;1,2,4-trimethylcyclohexane |
| SMILES | CC1CCC(C)C(C)C1.CC1COC(C)OC1 |
| InChI | InChI=1S/C9H18.C6H12O2/c1-7-4-5-8(2)9(3)6-7;1-5-3-7-6(2)8-4-5/h7-9H,4-6H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | KFQCOEPNQNJALU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |