About 2-cycloheptyl-1,3-oxazepane
2-cycloheptyl-1,3-oxazepane (PubChem CID 175475084) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-cycloheptyl-1,3-oxazepane.
Molecular Properties
| Compound Name | 2-cycloheptyl-1,3-oxazepane |
| PubChem CID | 175475084 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-cycloheptyl-1,3-oxazepane |
| SMILES | C1CCCC(C2NCCCCO2)CC1 |
| InChI | InChI=1S/C12H23NO/c1-2-4-8-11(7-3-1)12-13-9-5-6-10-14-12/h11-13H,1-10H2 |
| InChIKey | YVGBLMPELDFJFJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cycloheptyl-1,3-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-1,3-oxazepane?
The IUPAC name of 2-cycloheptyl-1,3-oxazepane (CID 175475084) is 2-cycloheptyl-1,3-oxazepane.
What is the SMILES notation for 2-cycloheptyl-1,3-oxazepane?
The canonical SMILES for 2-cycloheptyl-1,3-oxazepane is C1CCCC(C2NCCCCO2)CC1.
What is the InChIKey of 2-cycloheptyl-1,3-oxazepane?
The InChIKey is YVGBLMPELDFJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-2-4-8-11(7-3-1)12-13-9-5-6-10-14-12/h11-13H,1-10H2.
What are the key properties of 2-cycloheptyl-1,3-oxazepane?
2-cycloheptyl-1,3-oxazepane has a molecular weight of 197.32 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-1,3-oxazepane is sourced from PubChem (CID 175475084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).