C9H18N2O — CID 174654499
2-(azepan-2-yl)-1,3-oxazolidine (PubChem CID 174654499) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(azepan-2-yl)-1,3-oxazolidine.
| Compound Name | 2-(azepan-2-yl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 174654499 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-(azepan-2-yl)-1,3-oxazolidine |
| SMILES | C1CCNC(C2NCCO2)CC1 |
| InChI | InChI=1S/C9H18N2O/c1-2-4-8(10-5-3-1)9-11-6-7-12-9/h8-11H,1-7H2 |
| InChIKey | DOEICJHCIWWAED-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |