About 2-(azepan-2-yl)-1,3-oxazolidine
2-(azepan-2-yl)-1,3-oxazolidine (PubChem CID 174654499) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(azepan-2-yl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(azepan-2-yl)-1,3-oxazolidine |
| PubChem CID | 174654499 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-(azepan-2-yl)-1,3-oxazolidine |
| SMILES | C1CCNC(C2NCCO2)CC1 |
| InChI | InChI=1S/C9H18N2O/c1-2-4-8(10-5-3-1)9-11-6-7-12-9/h8-11H,1-7H2 |
| InChIKey | DOEICJHCIWWAED-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(azepan-2-yl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-2-yl)-1,3-oxazolidine?
The IUPAC name of 2-(azepan-2-yl)-1,3-oxazolidine (CID 174654499) is 2-(azepan-2-yl)-1,3-oxazolidine.
What is the SMILES notation for 2-(azepan-2-yl)-1,3-oxazolidine?
The canonical SMILES for 2-(azepan-2-yl)-1,3-oxazolidine is C1CCNC(C2NCCO2)CC1.
What is the InChIKey of 2-(azepan-2-yl)-1,3-oxazolidine?
The InChIKey is DOEICJHCIWWAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-2-4-8(10-5-3-1)9-11-6-7-12-9/h8-11H,1-7H2.
What are the key properties of 2-(azepan-2-yl)-1,3-oxazolidine?
2-(azepan-2-yl)-1,3-oxazolidine has a molecular weight of 170.26 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-2-yl)-1,3-oxazolidine is sourced from PubChem (CID 174654499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).