About 2-piperidin-2-yl-1,3-oxazinane;hydrochloride
2-piperidin-2-yl-1,3-oxazinane;hydrochloride (PubChem CID 117225945) has the molecular formula C9H19ClN2O
and a molecular weight of 206.72 g/mol. Its IUPAC name is 2-piperidin-2-yl-1,3-oxazinane;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-2-yl-1,3-oxazinane;hydrochloride |
| PubChem CID | 117225945 |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-piperidin-2-yl-1,3-oxazinane;hydrochloride |
| SMILES | C1CCC(C2NCCCO2)NC1.Cl |
| InChI | InChI=1S/C9H18N2O.ClH/c1-2-5-10-8(4-1)9-11-6-3-7-12-9;/h8-11H,1-7H2;1H |
| InChIKey | SRMBIAHXJJQXCL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-2-yl-1,3-oxazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-2-yl-1,3-oxazinane;hydrochloride?
The IUPAC name of 2-piperidin-2-yl-1,3-oxazinane;hydrochloride (CID 117225945) is 2-piperidin-2-yl-1,3-oxazinane;hydrochloride.
What is the SMILES notation for 2-piperidin-2-yl-1,3-oxazinane;hydrochloride?
The canonical SMILES for 2-piperidin-2-yl-1,3-oxazinane;hydrochloride is C1CCC(C2NCCCO2)NC1.Cl.
What is the InChIKey of 2-piperidin-2-yl-1,3-oxazinane;hydrochloride?
The InChIKey is SRMBIAHXJJQXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.ClH/c1-2-5-10-8(4-1)9-11-6-3-7-12-9;/h8-11H,1-7H2;1H.
What are the key properties of 2-piperidin-2-yl-1,3-oxazinane;hydrochloride?
2-piperidin-2-yl-1,3-oxazinane;hydrochloride has a molecular weight of 206.72 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-2-yl-1,3-oxazinane;hydrochloride is sourced from PubChem (CID 117225945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).