C11H21N — CID 138485504
2-cyclopentyl-4,4-dimethylpyrrolidine (PubChem CID 138485504) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-cyclopentyl-4,4-dimethylpyrrolidine.
| Compound Name | 2-cyclopentyl-4,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 138485504 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-cyclopentyl-4,4-dimethylpyrrolidine |
| SMILES | CC1(C)CNC(C2CCCC2)C1 |
| InChI | InChI=1S/C11H21N/c1-11(2)7-10(12-8-11)9-5-3-4-6-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | WEZUUHRADAONNF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |