C11H25NS2 — CID 159381950
(4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoline;sulfane (PubChem CID 159381950) has the molecular formula C11H25NS2 and a molecular weight of 235.46 g/mol. Its IUPAC name is (4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoline;sulfane.
| Compound Name | (4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoline;sulfane |
|---|---|
| PubChem CID | 159381950 |
| Molecular Formula | C11H25NS2 |
| Molecular Weight | 235.46 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoline;sulfane |
| SMILES | CC1(C)CN[C@H]2CCCC[C@@H]2C1.S.S |
| InChI | InChI=1S/C11H21N.2H2S/c1-11(2)7-9-5-3-4-6-10(9)12-8-11;;/h9-10,12H,3-8H2,1-2H3;2*1H2/t9-,10+;;/m1../s1 |
| InChIKey | LLAGDGUNOAHUEF-NKRBYZSKSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |