About 2-cyclohexylaziridine
2-cyclohexylaziridine (PubChem CID 14342017) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is 2-cyclohexylaziridine.
Molecular Properties
| Compound Name | 2-cyclohexylaziridine |
| PubChem CID | 14342017 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2-cyclohexylaziridine |
| SMILES | C1CCC(C2CN2)CC1 |
| InChI | InChI=1S/C8H15N/c1-2-4-7(5-3-1)8-6-9-8/h7-9H,1-6H2 |
| InChIKey | YQVZLVXTBKNYNY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylaziridine?
The IUPAC name of 2-cyclohexylaziridine (CID 14342017) is 2-cyclohexylaziridine.
What is the SMILES notation for 2-cyclohexylaziridine?
The canonical SMILES for 2-cyclohexylaziridine is C1CCC(C2CN2)CC1.
What is the InChIKey of 2-cyclohexylaziridine?
The InChIKey is YQVZLVXTBKNYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-2-4-7(5-3-1)8-6-9-8/h7-9H,1-6H2.
What are the key properties of 2-cyclohexylaziridine?
2-cyclohexylaziridine has a molecular weight of 125.22 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylaziridine is sourced from PubChem (CID 14342017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).