About 2-cyclohexylpiperazine;piperazine
2-cyclohexylpiperazine;piperazine (PubChem CID 22400875) has the molecular formula C14H30N4
and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-cyclohexylpiperazine;piperazine.
Molecular Properties
| Compound Name | 2-cyclohexylpiperazine;piperazine |
| PubChem CID | 22400875 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 2-cyclohexylpiperazine;piperazine |
| SMILES | C1CCC(C2CNCCN2)CC1.C1CNCCN1 |
| InChI | InChI=1S/C10H20N2.C4H10N2/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;1-2-6-4-3-5-1/h9-12H,1-8H2;5-6H,1-4H2 |
| InChIKey | FXMBQRGIGDGZCN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexylpiperazine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpiperazine;piperazine?
The IUPAC name of 2-cyclohexylpiperazine;piperazine (CID 22400875) is 2-cyclohexylpiperazine;piperazine.
What is the SMILES notation for 2-cyclohexylpiperazine;piperazine?
The canonical SMILES for 2-cyclohexylpiperazine;piperazine is C1CCC(C2CNCCN2)CC1.C1CNCCN1.
What is the InChIKey of 2-cyclohexylpiperazine;piperazine?
The InChIKey is FXMBQRGIGDGZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.C4H10N2/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;1-2-6-4-3-5-1/h9-12H,1-8H2;5-6H,1-4H2.
What are the key properties of 2-cyclohexylpiperazine;piperazine?
2-cyclohexylpiperazine;piperazine has a molecular weight of 254.42 g/mol, XLogP of 0.31, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpiperazine;piperazine is sourced from PubChem (CID 22400875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).