C11H23N3 — CID 134482589
5-(azepan-3-yl)-1,4-diazepane (PubChem CID 134482589) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 5-(azepan-3-yl)-1,4-diazepane.
| Compound Name | 5-(azepan-3-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 134482589 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 5-(azepan-3-yl)-1,4-diazepane |
| SMILES | C1CCC(C2CCNCCN2)CNC1 |
| InChI | InChI=1S/C11H23N3/c1-2-5-13-9-10(3-1)11-4-6-12-7-8-14-11/h10-14H,1-9H2 |
| InChIKey | JPSDNARIBNGZKC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |