C9H18N2 — CID 23282830
2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-pyrido[3,4-b]azepine (PubChem CID 23282830) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-pyrido[3,4-b]azepine.
| Compound Name | 2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-pyrido[3,4-b]azepine |
|---|---|
| PubChem CID | 23282830 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-pyrido[3,4-b]azepine |
| SMILES | C1CCC2CCNCC2NC1 |
| InChI | InChI=1S/C9H18N2/c1-2-5-11-9-7-10-6-4-8(9)3-1/h8-11H,1-7H2 |
| InChIKey | ROCPEWXRYVMBAS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |