C10H20ClNO2 — CID 117226426
5,5-dimethyl-2-(oxolan-2-yl)-1,3-oxazinane;hydrochloride (PubChem CID 117226426) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 5,5-dimethyl-2-(oxolan-2-yl)-1,3-oxazinane;hydrochloride.
| Compound Name | 5,5-dimethyl-2-(oxolan-2-yl)-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117226426 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5,5-dimethyl-2-(oxolan-2-yl)-1,3-oxazinane;hydrochloride |
| SMILES | CC1(C)CNC(C2CCCO2)OC1.Cl |
| InChI | InChI=1S/C10H19NO2.ClH/c1-10(2)6-11-9(13-7-10)8-4-3-5-12-8;/h8-9,11H,3-7H2,1-2H3;1H |
| InChIKey | DGRJLOLXJSCUCI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |