methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate

C12H21NO4S — CID 117269926

IUPACmethyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CC(CC2CCS(=O)(=O)CC2)CN1
InChIInChI=1S/C12H21NO4S/c1-17-12(14)11-7-10(8-13-11)6-9-2-4-18(15,16)5-3-9/h9-11,13H,2-8H2,1H3
InChIKeyYQNJFZFKSQPRPJ-UHFFFAOYSA-N
MW275.37 g/mol
LogP0.35
Rot. Bonds3

About methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate

methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 117269926) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate
PubChem CID117269926
Molecular FormulaC12H21NO4S
Molecular Weight275.37 g/mol
Exact Mass275.12
IUPAC Namemethyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CC(CC2CCS(=O)(=O)CC2)CN1
InChIInChI=1S/C12H21NO4S/c1-17-12(14)11-7-10(8-13-11)6-9-2-4-18(15,16)5-3-9/h9-11,13H,2-8H2,1H3
InChIKeyYQNJFZFKSQPRPJ-UHFFFAOYSA-N
XLogP0.35
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.37
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate?
The IUPAC name of methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate (CID 117269926) is methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate is COC(=O)C1CC(CC2CCS(=O)(=O)CC2)CN1.
What is the InChIKey of methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate?
The InChIKey is YQNJFZFKSQPRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4S/c1-17-12(14)11-7-10(8-13-11)6-9-2-4-18(15,16)5-3-9/h9-11,13H,2-8H2,1H3.
What are the key properties of methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate?
methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate has a molecular weight of 275.37 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1,1-dioxothian-4-yl)methyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 117269926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).