C7H13NO3S — CID 178199509
(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydrothiopyrano[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 178199509) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydrothiopyrano[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydrothiopyrano[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 178199509 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydrothiopyrano[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | O=S1(=O)CC[C@H]2NCCO[C@H]2C1 |
| InChI | InChI=1S/C7H13NO3S/c9-12(10)4-1-6-7(5-12)11-3-2-8-6/h6-8H,1-5H2/t6-,7+/m1/s1 |
| InChIKey | XRRKIHHUUPNLCC-RQJHMYQMSA-N |
| XLogP | -0.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |