C5H8O3S — CID 21498592
7-oxa-3λ6-thiabicyclo[4.1.0]heptane 3,3-dioxide (PubChem CID 21498592) has the molecular formula C5H8O3S and a molecular weight of 148.18 g/mol. Its IUPAC name is 7-oxa-3λ6-thiabicyclo[4.1.0]heptane 3,3-dioxide.
| Compound Name | 7-oxa-3λ6-thiabicyclo[4.1.0]heptane 3,3-dioxide |
|---|---|
| PubChem CID | 21498592 |
| Molecular Formula | C5H8O3S |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | 7-oxa-3λ6-thiabicyclo[4.1.0]heptane 3,3-dioxide |
| SMILES | O=S1(=O)CCC2OC2C1 |
| InChI | InChI=1S/C5H8O3S/c6-9(7)2-1-4-5(3-9)8-4/h4-5H,1-3H2 |
| InChIKey | ILEQCYFSRAWWHC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|