C4H8O3S — CID 98144245
(3S)-1,1-dioxothiolan-3-ol (PubChem CID 98144245) has the molecular formula C4H8O3S and a molecular weight of 138.17 g/mol. Its IUPAC name is (3S)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 98144245 |
| Molecular Formula | C4H8O3S |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | (3S)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC[C@H]([18OH])C1 |
| InChI | InChI=1S/C4H8O3S/c5-4-1-2-8(6,7)3-4/h4-5H,1-3H2/t4-/m0/s1/i5+2 |
| InChIKey | AMXKVIWWXBYXRS-QRTGCQPVSA-N |
| XLogP | -0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |