C5H12N2O2S — CID 124661417
(3S,4R)-1,1-dioxothiane-3,4-diamine (PubChem CID 124661417) has the molecular formula C5H12N2O2S and a molecular weight of 164.23 g/mol. Its IUPAC name is (3S,4R)-1,1-dioxothiane-3,4-diamine.
| Compound Name | (3S,4R)-1,1-dioxothiane-3,4-diamine |
|---|---|
| PubChem CID | 124661417 |
| Molecular Formula | C5H12N2O2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (3S,4R)-1,1-dioxothiane-3,4-diamine |
| SMILES | N[C@@H]1CCS(=O)(=O)C[C@H]1N |
| InChI | InChI=1S/C5H12N2O2S/c6-4-1-2-10(8,9)3-5(4)7/h4-5H,1-3,6-7H2/t4-,5-/m1/s1 |
| InChIKey | LDHIEFRKRKWYDH-RFZPGFLSSA-N |
| XLogP | -1.54 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |