C4H11NO6S2 — CID 154884353
1,1-dioxothiolan-3-amine;sulfuric acid (PubChem CID 154884353) has the molecular formula C4H11NO6S2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1,1-dioxothiolan-3-amine;sulfuric acid.
| Compound Name | 1,1-dioxothiolan-3-amine;sulfuric acid |
|---|---|
| PubChem CID | 154884353 |
| Molecular Formula | C4H11NO6S2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 1,1-dioxothiolan-3-amine;sulfuric acid |
| SMILES | NC1CCS(=O)(=O)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C4H9NO2S.H2O4S/c5-4-1-2-8(6,7)3-4;1-5(2,3)4/h4H,1-3,5H2;(H2,1,2,3,4) |
| InChIKey | KPYWIDAADYISMN-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|