C5H10INO2S — CID 89493495
(3S,4S)-3-iodo-1,1-dioxothian-4-amine (PubChem CID 89493495) has the molecular formula C5H10INO2S and a molecular weight of 275.11 g/mol. Its IUPAC name is (3S,4S)-3-iodo-1,1-dioxothian-4-amine.
| Compound Name | (3S,4S)-3-iodo-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 89493495 |
| Molecular Formula | C5H10INO2S |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | (3S,4S)-3-iodo-1,1-dioxothian-4-amine |
| SMILES | N[C@H]1CCS(=O)(=O)C[C@H]1I |
| InChI | InChI=1S/C5H10INO2S/c6-4-3-10(8,9)2-1-5(4)7/h4-5H,1-3,7H2/t4-,5+/m1/s1 |
| InChIKey | WQDLVTPOBDAHCG-UHNVWZDZSA-N |
| XLogP | -0.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|