C12H17NO2S — CID 84799838
3-(2-methylphenyl)-1,1-dioxothian-4-amine (PubChem CID 84799838) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1,1-dioxothian-4-amine.
| Compound Name | 3-(2-methylphenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 84799838 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-(2-methylphenyl)-1,1-dioxothian-4-amine |
| SMILES | Cc1ccccc1C1CS(=O)(=O)CCC1N |
| InChI | InChI=1S/C12H17NO2S/c1-9-4-2-3-5-10(9)11-8-16(14,15)7-6-12(11)13/h2-5,11-12H,6-8,13H2,1H3 |
| InChIKey | QORWNEKQVACBFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |