C12H18O2S — CID 70637540
3-methylthiolane 1,1-dioxide;toluene (PubChem CID 70637540) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-methylthiolane 1,1-dioxide;toluene.
| Compound Name | 3-methylthiolane 1,1-dioxide;toluene |
|---|---|
| PubChem CID | 70637540 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-methylthiolane 1,1-dioxide;toluene |
| SMILES | CC1CCS(=O)(=O)C1.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C5H10O2S/c1-7-5-3-2-4-6-7;1-5-2-3-8(6,7)4-5/h2-6H,1H3;5H,2-4H2,1H3 |
| InChIKey | ZFKVRWGGAUXPBA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |