About 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide
3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79453651) has the molecular formula C14H18Cl2O2S
and a molecular weight of 321.27 g/mol. Its IUPAC name is 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide |
| PubChem CID | 79453651 |
| Molecular Formula | C14H18Cl2O2S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cc1cccc(C(CCl)(CCl)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H18Cl2O2S/c1-11-3-2-4-12(7-11)14(9-15,10-16)13-5-6-19(17,18)8-13/h2-4,7,13H,5-6,8-10H2,1H3 |
| InChIKey | CWVXAOQQOLAPHX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide?
The IUPAC name of 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide (CID 79453651) is 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide is Cc1cccc(C(CCl)(CCl)C2CCS(=O)(=O)C2)c1.
What is the InChIKey of 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide?
The InChIKey is CWVXAOQQOLAPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2O2S/c1-11-3-2-4-12(7-11)14(9-15,10-16)13-5-6-19(17,18)8-13/h2-4,7,13H,5-6,8-10H2,1H3.
What are the key properties of 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide?
3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide has a molecular weight of 321.27 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-dichloro-2-(3-methylphenyl)propan-2-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 79453651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).