C12H16Cl2O2S2 — CID 79447281
3-[1-chloro-2-(chloromethyl)-3-thiophen-2-ylpropan-2-yl]thiolane 1,1-dioxide (PubChem CID 79447281) has the molecular formula C12H16Cl2O2S2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)-3-thiophen-2-ylpropan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)-3-thiophen-2-ylpropan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79447281 |
| Molecular Formula | C12H16Cl2O2S2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)-3-thiophen-2-ylpropan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)(CCl)Cc2cccs2)C1 |
| InChI | InChI=1S/C12H16Cl2O2S2/c13-8-12(9-14,6-11-2-1-4-17-11)10-3-5-18(15,16)7-10/h1-2,4,10H,3,5-9H2 |
| InChIKey | PBAQNNJZHOSGBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|