C14H16BrCl2FO2S — CID 79446033
3-[1-(4-bromo-2-fluorophenyl)-3-chloro-2-(chloromethyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79446033) has the molecular formula C14H16BrCl2FO2S and a molecular weight of 418.16 g/mol. Its IUPAC name is 3-[1-(4-bromo-2-fluorophenyl)-3-chloro-2-(chloromethyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-(4-bromo-2-fluorophenyl)-3-chloro-2-(chloromethyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79446033 |
| Molecular Formula | C14H16BrCl2FO2S |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 3-[1-(4-bromo-2-fluorophenyl)-3-chloro-2-(chloromethyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)(CCl)Cc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C14H16BrCl2FO2S/c15-12-2-1-10(13(18)5-12)6-14(8-16,9-17)11-3-4-21(19,20)7-11/h1-2,5,11H,3-4,6-9H2 |
| InChIKey | DUTSKJXRRWGPLT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|