C14H16Cl2F2O2S — CID 79446030
3-[1-chloro-2-(chloromethyl)-3-(2,5-difluorophenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79446030) has the molecular formula C14H16Cl2F2O2S and a molecular weight of 357.25 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)-3-(2,5-difluorophenyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)-3-(2,5-difluorophenyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79446030 |
| Molecular Formula | C14H16Cl2F2O2S |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)-3-(2,5-difluorophenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)(CCl)Cc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C14H16Cl2F2O2S/c15-8-14(9-16,11-3-4-21(19,20)7-11)6-10-5-12(17)1-2-13(10)18/h1-2,5,11H,3-4,6-9H2 |
| InChIKey | FTAKRTWNIBMPEC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|