C11H12ClFO2S — CID 160778148
3-[(4-chloro-2-fluorophenyl)methyl]thiolane 1,1-dioxide (PubChem CID 160778148) has the molecular formula C11H12ClFO2S and a molecular weight of 262.73 g/mol. Its IUPAC name is 3-[(4-chloro-2-fluorophenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(4-chloro-2-fluorophenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 160778148 |
| Molecular Formula | C11H12ClFO2S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 3-[(4-chloro-2-fluorophenyl)methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cc2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C11H12ClFO2S/c12-10-2-1-9(11(13)6-10)5-8-3-4-16(14,15)7-8/h1-2,6,8H,3-5,7H2 |
| InChIKey | SAFMBUYBCUBRDL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |