C12H16Cl2O3S — CID 83183035
3-[1-chloro-2-(chloromethyl)-3-(furan-3-yl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 83183035) has the molecular formula C12H16Cl2O3S and a molecular weight of 311.23 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)-3-(furan-3-yl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)-3-(furan-3-yl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 83183035 |
| Molecular Formula | C12H16Cl2O3S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)-3-(furan-3-yl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)(CCl)Cc2ccoc2)C1 |
| InChI | InChI=1S/C12H16Cl2O3S/c13-8-12(9-14,5-10-1-3-17-6-10)11-2-4-18(15,16)7-11/h1,3,6,11H,2,4-5,7-9H2 |
| InChIKey | ZQUYJGCETSFSIH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|