C10H16Cl2N4O2S — CID 107058447
3-[1-chloro-2-(chloromethyl)-3-(2-methyltetrazol-5-yl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 107058447) has the molecular formula C10H16Cl2N4O2S and a molecular weight of 327.24 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)-3-(2-methyltetrazol-5-yl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)-3-(2-methyltetrazol-5-yl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 107058447 |
| Molecular Formula | C10H16Cl2N4O2S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)-3-(2-methyltetrazol-5-yl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cn1nnc(CC(CCl)(CCl)C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H16Cl2N4O2S/c1-16-14-9(13-15-16)4-10(6-11,7-12)8-2-3-19(17,18)5-8/h8H,2-7H2,1H3 |
| InChIKey | SZFVTOKBXPJOAO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|