C11H20Cl2O4S2 — CID 79448392
3-[1-chloro-2-(chloromethyl)-4-ethylsulfonylbutan-2-yl]thiolane 1,1-dioxide (PubChem CID 79448392) has the molecular formula C11H20Cl2O4S2 and a molecular weight of 351.32 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)-4-ethylsulfonylbutan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)-4-ethylsulfonylbutan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79448392 |
| Molecular Formula | C11H20Cl2O4S2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)-4-ethylsulfonylbutan-2-yl]thiolane 1,1-dioxide |
| SMILES | CCS(=O)(=O)CCC(CCl)(CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20Cl2O4S2/c1-2-18(14,15)6-4-11(8-12,9-13)10-3-5-19(16,17)7-10/h10H,2-9H2,1H3 |
| InChIKey | AQSXVVGNCUFCRK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|