C13H24Br2O3S — CID 112592545
3-[1-bromo-2-(bromomethyl)-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide (PubChem CID 112592545) has the molecular formula C13H24Br2O3S and a molecular weight of 420.21 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 112592545 |
| Molecular Formula | C13H24Br2O3S |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]thiolane 1,1-dioxide |
| SMILES | CC(C)(C)OCCC(CBr)(CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24Br2O3S/c1-12(2,3)18-6-5-13(9-14,10-15)11-4-7-19(16,17)8-11/h11H,4-10H2,1-3H3 |
| InChIKey | JFXFZUHVLUVVHH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|