C13H26O6S — CID 103185078
2-(1,1-dioxothiolan-3-yl)-2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol (PubChem CID 103185078) has the molecular formula C13H26O6S and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 103185078 |
| Molecular Formula | C13H26O6S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-[2-(3-methoxypropoxy)ethyl]propane-1,3-diol |
| SMILES | COCCCOCCC(CO)(CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26O6S/c1-18-5-2-6-19-7-4-13(10-14,11-15)12-3-8-20(16,17)9-12/h12,14-15H,2-11H2,1H3 |
| InChIKey | MCRAIRSFEMJIHX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|