C8H18NO3S+ — CID 7128966
[(3S)-1,1-dioxothiolan-3-yl]-(3-methoxypropyl)azanium (PubChem CID 7128966) has the molecular formula C8H18NO3S+ and a molecular weight of 208.30 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-(3-methoxypropyl)azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7128966 |
| Molecular Formula | C8H18NO3S+ |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+][C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO3S/c1-12-5-2-4-9-8-3-6-13(10,11)7-8/h8-9H,2-7H2,1H3/p+1/t8-/m0/s1 |
| InChIKey | GLSXMAHJMNEFHZ-QMMMGPOBSA-O |
| XLogP | -1.23 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|