C16H32O4S — CID 164916307
4-(10-methoxydecoxy)thiane 1,1-dioxide (PubChem CID 164916307) has the molecular formula C16H32O4S and a molecular weight of 320.50 g/mol. Its IUPAC name is 4-(10-methoxydecoxy)thiane 1,1-dioxide.
| Compound Name | 4-(10-methoxydecoxy)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 164916307 |
| Molecular Formula | C16H32O4S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 4-(10-methoxydecoxy)thiane 1,1-dioxide |
| SMILES | COCCCCCCCCCCOC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H32O4S/c1-19-12-8-6-4-2-3-5-7-9-13-20-16-10-14-21(17,18)15-11-16/h16H,2-15H2,1H3 |
| InChIKey | WFZIKASSZSAVPY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|