C12H22O7S2 — CID 40549365
(3S)-3-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]oxyethoxy]ethoxy]thiolane 1,1-dioxide (PubChem CID 40549365) has the molecular formula C12H22O7S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3S)-3-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]oxyethoxy]ethoxy]thiolane 1,1-dioxide.
| Compound Name | (3S)-3-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]oxyethoxy]ethoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 40549365 |
| Molecular Formula | C12H22O7S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3S)-3-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]oxyethoxy]ethoxy]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H](OCCOCCO[C@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H22O7S2/c13-20(14)7-1-11(9-20)18-5-3-17-4-6-19-12-2-8-21(15,16)10-12/h11-12H,1-10H2/t11-,12-/m0/s1 |
| InChIKey | DSGSXJGUAOTSTK-RYUDHWBXSA-N |
| XLogP | -0.59 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|