C14H25NO6S2 — CID 99976873
N-[(3R)-1,1-dioxothiolan-3-yl]-N-[5-[(3R)-1,1-dioxothiolan-3-yl]oxypentyl]formamide (PubChem CID 99976873) has the molecular formula C14H25NO6S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-[5-[(3R)-1,1-dioxothiolan-3-yl]oxypentyl]formamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[5-[(3R)-1,1-dioxothiolan-3-yl]oxypentyl]formamide |
|---|---|
| PubChem CID | 99976873 |
| Molecular Formula | C14H25NO6S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[5-[(3R)-1,1-dioxothiolan-3-yl]oxypentyl]formamide |
| SMILES | O=CN(CCCCCO[C@@H]1CCS(=O)(=O)C1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO6S2/c16-12-15(13-4-8-22(17,18)10-13)6-2-1-3-7-21-14-5-9-23(19,20)11-14/h12-14H,1-11H2/t13-,14-/m1/s1 |
| InChIKey | HDKQYCOTFPCXQY-ZIAGYGMSSA-N |
| XLogP | 0.01 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|