C12H20N2O6S2 — CID 99976773
N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]formamide (PubChem CID 99976773) has the molecular formula C12H20N2O6S2 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]formamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]formamide |
|---|---|
| PubChem CID | 99976773 |
| Molecular Formula | C12H20N2O6S2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]formamide |
| SMILES | O=CN(CCN(C=O)[C@H]1CCS(=O)(=O)C1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O6S2/c15-9-13(11-1-5-21(17,18)7-11)3-4-14(10-16)12-2-6-22(19,20)8-12/h9-12H,1-8H2/t11-,12+ |
| InChIKey | GONLWBBZUWFJPE-TXEJJXNPSA-N |
| XLogP | -1.72 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|