C12H21NO6S2 — CID 99976860
N-[(3S)-1,1-dioxothiolan-3-yl]-N-[3-[(3S)-1,1-dioxothiolan-3-yl]oxypropyl]formamide (PubChem CID 99976860) has the molecular formula C12H21NO6S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-[3-[(3S)-1,1-dioxothiolan-3-yl]oxypropyl]formamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-[3-[(3S)-1,1-dioxothiolan-3-yl]oxypropyl]formamide |
|---|---|
| PubChem CID | 99976860 |
| Molecular Formula | C12H21NO6S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-[3-[(3S)-1,1-dioxothiolan-3-yl]oxypropyl]formamide |
| SMILES | O=CN(CCCO[C@H]1CCS(=O)(=O)C1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO6S2/c14-10-13(11-2-6-20(15,16)8-11)4-1-5-19-12-3-7-21(17,18)9-12/h10-12H,1-9H2/t11-,12-/m0/s1 |
| InChIKey | YGJQEGRHSHSHSS-RYUDHWBXSA-N |
| XLogP | -0.77 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|