C10H19NO5S2 — CID 46398595
N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-1,1-dioxothiolan-3-amine (PubChem CID 46398595) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 46398595 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCCOC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C10H19NO5S2/c12-17(13)5-1-9(7-17)11-3-4-16-10-2-6-18(14,15)8-10/h9-11H,1-8H2 |
| InChIKey | CQXSSBSHSKLFAC-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|