C10H18N2O4S — CID 99977281
N-[2-[[(3R)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]propanamide (PubChem CID 99977281) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[2-[[(3R)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]propanamide.
| Compound Name | N-[2-[[(3R)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 99977281 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[2-[[(3R)-1,1-dioxothiolan-3-yl]-formylamino]ethyl]propanamide |
| SMILES | CCC(=O)NCCN(C=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O4S/c1-2-10(14)11-4-5-12(8-13)9-3-6-17(15,16)7-9/h8-9H,2-7H2,1H3,(H,11,14)/t9-/m1/s1 |
| InChIKey | ZWPBKRKYOBRBJK-SECBINFHSA-N |
| XLogP | -0.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|