C13H24N2O4S — CID 113056020
N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]pentanamide (PubChem CID 113056020) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]pentanamide.
| Compound Name | N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 113056020 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCN(C(C)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24N2O4S/c1-3-4-5-13(17)14-7-8-15(11(2)16)12-6-9-20(18,19)10-12/h12H,3-10H2,1-2H3,(H,14,17) |
| InChIKey | UOJNAHARHAYXOB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |