C17H24N2O6S — CID 113056040
N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]-2,6-dimethoxybenzamide (PubChem CID 113056040) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 113056040 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[2-[acetyl-(1,1-dioxothiolan-3-yl)amino]ethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCN(C(C)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O6S/c1-12(20)19(13-7-10-26(22,23)11-13)9-8-18-17(21)16-14(24-2)5-4-6-15(16)25-3/h4-6,13H,7-11H2,1-3H3,(H,18,21) |
| InChIKey | KIDPGTWXUXRDLV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |