C11H21NO3S — CID 123376891
N-butyl-N-(1,1-dioxothian-4-yl)acetamide (PubChem CID 123376891) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothian-4-yl)acetamide.
| Compound Name | N-butyl-N-(1,1-dioxothian-4-yl)acetamide |
|---|---|
| PubChem CID | 123376891 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-butyl-N-(1,1-dioxothian-4-yl)acetamide |
| SMILES | CCCCN(C(C)=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO3S/c1-3-4-7-12(10(2)13)11-5-8-16(14,15)9-6-11/h11H,3-9H2,1-2H3 |
| InChIKey | LVFPWDZEERTPED-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |