C19H31NO3S — CID 134026791
N-butyl-N-(1,1-dioxothiolan-3-yl)adamantane-2-carboxamide (PubChem CID 134026791) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)adamantane-2-carboxamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)adamantane-2-carboxamide |
|---|---|
| PubChem CID | 134026791 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)adamantane-2-carboxamide |
| SMILES | CCCCN(C(=O)C1C2CC3CC(C2)CC1C3)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H31NO3S/c1-2-3-5-20(17-4-6-24(22,23)12-17)19(21)18-15-8-13-7-14(10-15)11-16(18)9-13/h13-18H,2-12H2,1H3 |
| InChIKey | LIBWMCAKGVMYLD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |