C10H21NO3S — CID 59691476
2-[tert-butyl-(1,1-dioxothiolan-3-yl)amino]ethanol (PubChem CID 59691476) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-[tert-butyl-(1,1-dioxothiolan-3-yl)amino]ethanol.
| Compound Name | 2-[tert-butyl-(1,1-dioxothiolan-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 59691476 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[tert-butyl-(1,1-dioxothiolan-3-yl)amino]ethanol |
| SMILES | CC(C)(C)N(CCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO3S/c1-10(2,3)11(5-6-12)9-4-7-15(13,14)8-9/h9,12H,4-8H2,1-3H3 |
| InChIKey | HFNGGFPYYTZOML-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |