C10H19NO4S — CID 59831582
methyl N-tert-butyl-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 59831582) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is methyl N-tert-butyl-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | methyl N-tert-butyl-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 59831582 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl N-tert-butyl-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | COC(=O)N([C@H]1CCS(=O)(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C10H19NO4S/c1-10(2,3)11(9(12)15-4)8-5-6-16(13,14)7-8/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | QXHNAHFUZXJXSZ-QMMMGPOBSA-N |
| XLogP | 1.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |