C12H21NO5S — CID 112752233
methyl 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxobutanoate (PubChem CID 112752233) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is methyl 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxobutanoate.
| Compound Name | methyl 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 112752233 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxobutanoate |
| SMILES | COC(=O)C(C)(C)C(=O)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO5S/c1-12(2,11(15)18-4)10(14)7-13(3)9-5-6-19(16,17)8-9/h9H,5-8H2,1-4H3 |
| InChIKey | FZNPZZCKILHDLG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|