C11H21NO3S — CID 110755793
N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide (PubChem CID 110755793) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 110755793 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)CC(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO3S/c1-11(2,3)7-10(13)12(4)9-5-6-16(14,15)8-9/h9H,5-8H2,1-4H3 |
| InChIKey | GPUJFLCRQVMDDI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |